C41H72O4 — CID 138251722
(Z)-10-[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]oxyhenicos-11-enoic acid (PubChem CID 138251722) has the molecular formula C41H72O4 and a molecular weight of 629.02 g/mol. Its IUPAC name is (Z)-10-[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]oxyhenicos-11-enoic acid.
| Compound Name | (Z)-10-[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]oxyhenicos-11-enoic acid |
|---|---|
| PubChem CID | 138251722 |
| Molecular Formula | C41H72O4 |
| Molecular Weight | 629.02 g/mol |
| Exact Mass | 628.54 |
| IUPAC Name | (Z)-10-[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]oxyhenicos-11-enoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCCCC(=O)OC(/C=C\CCCCCCCCC)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C41H72O4/c1-3-5-7-9-11-13-14-15-16-17-18-19-20-22-24-30-34-38-41(44)45-39(35-31-27-23-21-12-10-8-6-4-2)36-32-28-25-26-29-33-37-40(42)43/h5,7,11,13,15-16,31,35,39H,3-4,6,8-10,12,14,17-30,32-34,36-38H2,1-2H3,(H,42,43)/b7-5-,13-11-,16-15-,35-31- |
| InChIKey | RFYSGNLBEOPALZ-FQBXWMGVSA-N |
| XLogP | 13.17 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.02 |
| LogP ≤ 5 | 13.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|