C40H73O8P — CID 138244975
[2-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxy-3-[hydroxy(methoxy)phosphoryl]oxypropyl] (Z)-icos-11-enoate (PubChem CID 138244975) has the molecular formula C40H73O8P and a molecular weight of 712.99 g/mol. Its IUPAC name is [2-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxy-3-[hydroxy(methoxy)phosphoryl]oxypropyl] (Z)-icos-11-enoate.
| Compound Name | [2-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxy-3-[hydroxy(methoxy)phosphoryl]oxypropyl] (Z)-icos-11-enoate |
|---|---|
| PubChem CID | 138244975 |
| Molecular Formula | C40H73O8P |
| Molecular Weight | 712.99 g/mol |
| Exact Mass | 712.50 |
| IUPAC Name | [2-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxy-3-[hydroxy(methoxy)phosphoryl]oxypropyl] (Z)-icos-11-enoate |
| SMILES | CCC/C=C\C/C=C\CCCCCCCC(=O)OC(COC(=O)CCCCCCCCC/C=C\CCCCCCCC)COP(=O)(O)OC |
| InChI | InChI=1S/C40H73O8P/c1-4-6-8-10-12-14-16-18-19-20-21-23-24-26-28-30-32-34-39(41)46-36-38(37-47-49(43,44)45-3)48-40(42)35-33-31-29-27-25-22-17-15-13-11-9-7-5-2/h9,11,15,17-19,38H,4-8,10,12-14,16,20-37H2,1-3H3,(H,43,44)/b11-9-,17-15-,19-18- |
| InChIKey | QKXXYCZMMWZTMY-LSBIHQIWSA-N |
| XLogP | 12.06 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.99 |
| LogP ≤ 5 | 12.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|