C31H52NO10P — CID 138253337
2-amino-3-[[3-heptanoyloxy-2-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid (PubChem CID 138253337) has the molecular formula C31H52NO10P and a molecular weight of 629.73 g/mol. Its IUPAC name is 2-amino-3-[[3-heptanoyloxy-2-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid.
| Compound Name | 2-amino-3-[[3-heptanoyloxy-2-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 138253337 |
| Molecular Formula | C31H52NO10P |
| Molecular Weight | 629.73 g/mol |
| Exact Mass | 629.33 |
| IUPAC Name | 2-amino-3-[[3-heptanoyloxy-2-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCC(=O)OC(COC(=O)CCCCCC)COP(=O)(O)OCC(N)C(=O)O |
| InChI | InChI=1S/C31H52NO10P/c1-3-5-7-9-10-11-12-13-14-15-16-17-18-19-21-23-30(34)42-27(24-39-29(33)22-20-8-6-4-2)25-40-43(37,38)41-26-28(32)31(35)36/h5,7,10-11,13-14,16-17,27-28H,3-4,6,8-9,12,15,18-26,32H2,1-2H3,(H,35,36)(H,37,38)/b7-5-,11-10-,14-13-,17-16- |
| InChIKey | RKZRZXVNJZJESX-ZRENGBSJSA-N |
| XLogP | 6.32 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.73 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|