C16H20N2O2S2 — CID 1382652
(3aR,6aS)-3-(3,5-dimethylphenyl)-5,5-dioxo-1-prop-2-enyl-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole-2-thione (PubChem CID 1382652) has the molecular formula C16H20N2O2S2 and a molecular weight of 336.48 g/mol. Its IUPAC name is (3aR,6aS)-3-(3,5-dimethylphenyl)-5,5-dioxo-1-prop-2-enyl-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole-2-thione.
| Compound Name | (3aR,6aS)-3-(3,5-dimethylphenyl)-5,5-dioxo-1-prop-2-enyl-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole-2-thione |
|---|---|
| PubChem CID | 1382652 |
| Molecular Formula | C16H20N2O2S2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | (3aR,6aS)-3-(3,5-dimethylphenyl)-5,5-dioxo-1-prop-2-enyl-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole-2-thione |
| SMILES | C=CCN1C(=S)N(c2cc(C)cc(C)c2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C16H20N2O2S2/c1-4-5-17-14-9-22(19,20)10-15(14)18(16(17)21)13-7-11(2)6-12(3)8-13/h4,6-8,14-15H,1,5,9-10H2,2-3H3/t14-,15+/m1/s1 |
| InChIKey | ACICRKOLNTYEII-CABCVRRESA-N |
| XLogP | 2.06 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|