C18H16Cl2N2O2S2 — CID 6554508
(3aR,6aS)-3-(3,4-dichlorophenyl)-1-(4-methylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole-2-thione (PubChem CID 6554508) has the molecular formula C18H16Cl2N2O2S2 and a molecular weight of 427.38 g/mol. Its IUPAC name is (3aR,6aS)-3-(3,4-dichlorophenyl)-1-(4-methylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole-2-thione.
| Compound Name | (3aR,6aS)-3-(3,4-dichlorophenyl)-1-(4-methylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole-2-thione |
|---|---|
| PubChem CID | 6554508 |
| Molecular Formula | C18H16Cl2N2O2S2 |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 426.00 |
| IUPAC Name | (3aR,6aS)-3-(3,4-dichlorophenyl)-1-(4-methylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole-2-thione |
| SMILES | Cc1ccc(N2C(=S)N(c3ccc(Cl)c(Cl)c3)[C@H]3CS(=O)(=O)C[C@H]32)cc1 |
| InChI | InChI=1S/C18H16Cl2N2O2S2/c1-11-2-4-12(5-3-11)21-16-9-26(23,24)10-17(16)22(18(21)25)13-6-7-14(19)15(20)8-13/h2-8,16-17H,9-10H2,1H3/t16-,17+/m1/s1 |
| InChIKey | UTWXLWKYHILFFW-SJORKVTESA-N |
| XLogP | 4.08 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|