C18H13Cl2F3N2O3S — CID 3677073
1-(3,4-dichlorophenyl)-5,5-dioxo-3-[3-(trifluoromethyl)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-one (PubChem CID 3677073) has the molecular formula C18H13Cl2F3N2O3S and a molecular weight of 465.28 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-5,5-dioxo-3-[3-(trifluoromethyl)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-one.
| Compound Name | 1-(3,4-dichlorophenyl)-5,5-dioxo-3-[3-(trifluoromethyl)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-one |
|---|---|
| PubChem CID | 3677073 |
| Molecular Formula | C18H13Cl2F3N2O3S |
| Molecular Weight | 465.28 g/mol |
| Exact Mass | 464.00 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-5,5-dioxo-3-[3-(trifluoromethyl)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-one |
| SMILES | O=C1N(c2cccc(C(F)(F)F)c2)C2CS(=O)(=O)CC2N1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H13Cl2F3N2O3S/c19-13-5-4-12(7-14(13)20)25-16-9-29(27,28)8-15(16)24(17(25)26)11-3-1-2-10(6-11)18(21,22)23/h1-7,15-16H,8-9H2 |
| InChIKey | MUSMKQQMKCPXPX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.28 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|