C17H14ClFN2O2S2 — CID 8014573
(3aR,6aR)-3-(4-chlorophenyl)-1-(4-fluorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole-2-thione (PubChem CID 8014573) has the molecular formula C17H14ClFN2O2S2 and a molecular weight of 396.90 g/mol. Its IUPAC name is (3aR,6aR)-3-(4-chlorophenyl)-1-(4-fluorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole-2-thione.
| Compound Name | (3aR,6aR)-3-(4-chlorophenyl)-1-(4-fluorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole-2-thione |
|---|---|
| PubChem CID | 8014573 |
| Molecular Formula | C17H14ClFN2O2S2 |
| Molecular Weight | 396.90 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | (3aR,6aR)-3-(4-chlorophenyl)-1-(4-fluorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole-2-thione |
| SMILES | O=S1(=O)C[C@H]2[C@H](C1)N(c1ccc(Cl)cc1)C(=S)N2c1ccc(F)cc1 |
| InChI | InChI=1S/C17H14ClFN2O2S2/c18-11-1-5-13(6-2-11)20-15-9-25(22,23)10-16(15)21(17(20)24)14-7-3-12(19)4-8-14/h1-8,15-16H,9-10H2/t15-,16-/m0/s1 |
| InChIKey | RQNPAAXDCLQPRN-HOTGVXAUSA-N |
| XLogP | 3.26 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.90 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|