C18H16Cl2N2O3S2 — CID 2948597
3-(3,4-dichlorophenyl)-1-(4-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole-2-thione (PubChem CID 2948597) has the molecular formula C18H16Cl2N2O3S2 and a molecular weight of 443.38 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1-(4-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole-2-thione.
| Compound Name | 3-(3,4-dichlorophenyl)-1-(4-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole-2-thione |
|---|---|
| PubChem CID | 2948597 |
| Molecular Formula | C18H16Cl2N2O3S2 |
| Molecular Weight | 443.38 g/mol |
| Exact Mass | 442.00 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1-(4-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole-2-thione |
| SMILES | COc1ccc(N2C(=S)N(c3ccc(Cl)c(Cl)c3)C3CS(=O)(=O)CC32)cc1 |
| InChI | InChI=1S/C18H16Cl2N2O3S2/c1-25-13-5-2-11(3-6-13)21-16-9-27(23,24)10-17(16)22(18(21)26)12-4-7-14(19)15(20)8-12/h2-8,16-17H,9-10H2,1H3 |
| InChIKey | XLUBJAPNKGPJRX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|