C43H81N2O6P — CID 138267329
[(4E,8E,12E)-3-hydroxy-2-[[(Z)-icos-11-enoyl]amino]octadeca-4,8,12-trienyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 138267329) has the molecular formula C43H81N2O6P and a molecular weight of 753.10 g/mol. Its IUPAC name is [(4E,8E,12E)-3-hydroxy-2-[[(Z)-icos-11-enoyl]amino]octadeca-4,8,12-trienyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(4E,8E,12E)-3-hydroxy-2-[[(Z)-icos-11-enoyl]amino]octadeca-4,8,12-trienyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 138267329 |
| Molecular Formula | C43H81N2O6P |
| Molecular Weight | 753.10 g/mol |
| Exact Mass | 752.58 |
| IUPAC Name | [(4E,8E,12E)-3-hydroxy-2-[[(Z)-icos-11-enoyl]amino]octadeca-4,8,12-trienyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCC/C=C/CC/C=C/CC/C=C/C(O)C(COP(=O)([O-])OCC[N+](C)(C)C)NC(=O)CCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C43H81N2O6P/c1-6-8-10-12-14-16-18-20-21-22-23-25-27-29-31-33-35-37-43(47)44-41(40-51-52(48,49)50-39-38-45(3,4)5)42(46)36-34-32-30-28-26-24-19-17-15-13-11-9-7-2/h15,17,20-21,26,28,34,36,41-42,46H,6-14,16,18-19,22-25,27,29-33,35,37-40H2,1-5H3,(H-,44,47,48,49)/b17-15+,21-20-,28-26+,36-34+ |
| InChIKey | TVMABSGLCSWFTL-PEESVRNHSA-N |
| XLogP | 10.67 |
| TPSA | 107.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.10 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|