C36H62O5 — CID 138270501
[2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxy-3-hydroxypropyl] (Z)-heptadec-9-enoate (PubChem CID 138270501) has the molecular formula C36H62O5 and a molecular weight of 574.89 g/mol. Its IUPAC name is [2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxy-3-hydroxypropyl] (Z)-heptadec-9-enoate.
| Compound Name | [2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxy-3-hydroxypropyl] (Z)-heptadec-9-enoate |
|---|---|
| PubChem CID | 138270501 |
| Molecular Formula | C36H62O5 |
| Molecular Weight | 574.89 g/mol |
| Exact Mass | 574.46 |
| IUPAC Name | [2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxy-3-hydroxypropyl] (Z)-heptadec-9-enoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCC(=O)OC(CO)COC(=O)CCCCCCC/C=C\CCCCCCC |
| InChI | InChI=1S/C36H62O5/c1-3-5-7-9-11-13-15-17-19-20-22-24-26-28-30-35(38)40-33-34(32-37)41-36(39)31-29-27-25-23-21-18-16-14-12-10-8-6-4-2/h6,8,12,14-15,17-18,21,34,37H,3-5,7,9-11,13,16,19-20,22-33H2,1-2H3/b8-6-,14-12-,17-15-,21-18- |
| InChIKey | UFLMIUYBIGNKQI-YLVLOPAXSA-N |
| XLogP | 9.89 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.89 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|