C46H80NO8P — CID 138273742
[3-[(Z)-octadec-9-enoxy]-2-[4-[3-[(1E,3E,5Z,8Z,11Z)-tetradeca-1,3,5,8,11-pentaenyl]oxiran-2-yl]butanoyloxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 138273742) has the molecular formula C46H80NO8P and a molecular weight of 806.12 g/mol. Its IUPAC name is [3-[(Z)-octadec-9-enoxy]-2-[4-[3-[(1E,3E,5Z,8Z,11Z)-tetradeca-1,3,5,8,11-pentaenyl]oxiran-2-yl]butanoyloxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [3-[(Z)-octadec-9-enoxy]-2-[4-[3-[(1E,3E,5Z,8Z,11Z)-tetradeca-1,3,5,8,11-pentaenyl]oxiran-2-yl]butanoyloxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 138273742 |
| Molecular Formula | C46H80NO8P |
| Molecular Weight | 806.12 g/mol |
| Exact Mass | 805.56 |
| IUPAC Name | [3-[(Z)-octadec-9-enoxy]-2-[4-[3-[(1E,3E,5Z,8Z,11Z)-tetradeca-1,3,5,8,11-pentaenyl]oxiran-2-yl]butanoyloxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CC/C=C\C/C=C\C/C=C\C=C\C=C\C1OC1CCCC(=O)OC(COCCCCCCCC/C=C\CCCCCCCC)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C46H80NO8P/c1-6-8-10-12-14-16-18-20-21-22-23-25-27-29-31-33-39-51-41-43(42-53-56(49,50)52-40-38-47(3,4)5)54-46(48)37-34-36-45-44(55-45)35-32-30-28-26-24-19-17-15-13-11-9-7-2/h9,11,15,17,20-21,24,26,28,30,32,35,43-45H,6-8,10,12-14,16,18-19,22-23,25,27,29,31,33-34,36-42H2,1-5H3/b11-9-,17-15-,21-20-,26-24-,30-28+,35-32+ |
| InChIKey | UPMUTHOTWJLGEJ-GPRSWHEQSA-N |
| XLogP | 11.07 |
| TPSA | 106.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.12 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|