C46H80NO9P — CID 138129648
[3-[(Z)-octadec-9-enoyl]oxy-2-[4-[3-[(1Z,3Z,5E,8E)-tetradeca-1,3,5,8-tetraenyl]oxiran-2-yl]butanoyloxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 138129648) has the molecular formula C46H80NO9P and a molecular weight of 822.12 g/mol. Its IUPAC name is [3-[(Z)-octadec-9-enoyl]oxy-2-[4-[3-[(1Z,3Z,5E,8E)-tetradeca-1,3,5,8-tetraenyl]oxiran-2-yl]butanoyloxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [3-[(Z)-octadec-9-enoyl]oxy-2-[4-[3-[(1Z,3Z,5E,8E)-tetradeca-1,3,5,8-tetraenyl]oxiran-2-yl]butanoyloxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 138129648 |
| Molecular Formula | C46H80NO9P |
| Molecular Weight | 822.12 g/mol |
| Exact Mass | 821.56 |
| IUPAC Name | [3-[(Z)-octadec-9-enoyl]oxy-2-[4-[3-[(1Z,3Z,5E,8E)-tetradeca-1,3,5,8-tetraenyl]oxiran-2-yl]butanoyloxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCC/C=C/C/C=C/C=C\C=C/C1OC1CCCC(=O)OC(COC(=O)CCCCCCC/C=C\CCCCCCCC)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C46H80NO9P/c1-6-8-10-12-14-16-18-20-21-22-24-26-28-30-32-36-45(48)52-40-42(41-54-57(50,51)53-39-38-47(3,4)5)55-46(49)37-33-35-44-43(56-44)34-31-29-27-25-23-19-17-15-13-11-9-7-2/h15,17,20-21,23,25,27,29,31,34,42-44H,6-14,16,18-19,22,24,26,28,30,32-33,35-41H2,1-5H3/b17-15+,21-20-,25-23+,29-27-,34-31- |
| InChIKey | BRGLLOMCQRIEBL-YYSYXULNSA-N |
| XLogP | 10.82 |
| TPSA | 123.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.12 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|