C48H84NO9P — CID 156992048
[(2R)-3-[(11Z,14Z)-icosa-11,14-dienoyl]oxy-2-[4-[3-[(2Z,5Z,8Z)-tetradeca-2,5,8-trienyl]oxiran-2-yl]butanoyloxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 156992048) has the molecular formula C48H84NO9P and a molecular weight of 850.17 g/mol. Its IUPAC name is [(2R)-3-[(11Z,14Z)-icosa-11,14-dienoyl]oxy-2-[4-[3-[(2Z,5Z,8Z)-tetradeca-2,5,8-trienyl]oxiran-2-yl]butanoyloxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-3-[(11Z,14Z)-icosa-11,14-dienoyl]oxy-2-[4-[3-[(2Z,5Z,8Z)-tetradeca-2,5,8-trienyl]oxiran-2-yl]butanoyloxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 156992048 |
| Molecular Formula | C48H84NO9P |
| Molecular Weight | 850.17 g/mol |
| Exact Mass | 849.59 |
| IUPAC Name | [(2R)-3-[(11Z,14Z)-icosa-11,14-dienoyl]oxy-2-[4-[3-[(2Z,5Z,8Z)-tetradeca-2,5,8-trienyl]oxiran-2-yl]butanoyloxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CC1OC1CCCC(=O)O[C@H](COC(=O)CCCCCCCCC/C=C\C/C=C\CCCCC)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C48H84NO9P/c1-6-8-10-12-14-16-18-20-21-22-23-24-26-28-30-32-34-38-47(50)54-42-44(43-56-59(52,53)55-41-40-49(3,4)5)57-48(51)39-35-37-46-45(58-46)36-33-31-29-27-25-19-17-15-13-11-9-7-2/h14-17,20-21,25,27,31,33,44-46H,6-13,18-19,22-24,26,28-30,32,34-43H2,1-5H3/b16-14-,17-15-,21-20-,27-25-,33-31-/t44-,45?,46?/m1/s1 |
| InChIKey | LXVILYCLRDWHOE-FERGAPGOSA-N |
| XLogP | 11.60 |
| TPSA | 123.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.17 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|