C48H86NO9P — CID 156991828
[(2R)-3-[(Z)-icos-11-enoyl]oxy-2-[(5Z,8Z,11Z)-13-(3-pentyloxiran-2-yl)trideca-5,8,11-trienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 156991828) has the molecular formula C48H86NO9P and a molecular weight of 852.19 g/mol. Its IUPAC name is [(2R)-3-[(Z)-icos-11-enoyl]oxy-2-[(5Z,8Z,11Z)-13-(3-pentyloxiran-2-yl)trideca-5,8,11-trienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-3-[(Z)-icos-11-enoyl]oxy-2-[(5Z,8Z,11Z)-13-(3-pentyloxiran-2-yl)trideca-5,8,11-trienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 156991828 |
| Molecular Formula | C48H86NO9P |
| Molecular Weight | 852.19 g/mol |
| Exact Mass | 851.60 |
| IUPAC Name | [(2R)-3-[(Z)-icos-11-enoyl]oxy-2-[(5Z,8Z,11Z)-13-(3-pentyloxiran-2-yl)trideca-5,8,11-trienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCC(=O)OC[C@H](COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCC/C=C\C/C=C\C/C=C\CC1OC1CCCCC |
| InChI | InChI=1S/C48H86NO9P/c1-6-8-10-11-12-13-14-15-16-17-18-19-20-24-27-30-34-38-47(50)54-42-44(43-56-59(52,53)55-41-40-49(3,4)5)57-48(51)39-35-31-28-25-22-21-23-26-29-33-37-46-45(58-46)36-32-9-7-2/h15-16,21,23,25,28-29,33,44-46H,6-14,17-20,22,24,26-27,30-32,34-43H2,1-5H3/b16-15-,23-21-,28-25-,33-29-/t44-,45?,46?/m1/s1 |
| InChIKey | JQRXSZBHDQOVFE-IXKZWYADSA-N |
| XLogP | 11.82 |
| TPSA | 123.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.19 |
| LogP ≤ 5 | 11.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|