C27H51NO3 — CID 138277505
(Z)-N-[(E)-1,3-dihydroxytetradec-4-en-2-yl]tridec-8-enamide (PubChem CID 138277505) has the molecular formula C27H51NO3 and a molecular weight of 437.71 g/mol. Its IUPAC name is (Z)-N-[(E)-1,3-dihydroxytetradec-4-en-2-yl]tridec-8-enamide.
| Compound Name | (Z)-N-[(E)-1,3-dihydroxytetradec-4-en-2-yl]tridec-8-enamide |
|---|---|
| PubChem CID | 138277505 |
| Molecular Formula | C27H51NO3 |
| Molecular Weight | 437.71 g/mol |
| Exact Mass | 437.39 |
| IUPAC Name | (Z)-N-[(E)-1,3-dihydroxytetradec-4-en-2-yl]tridec-8-enamide |
| SMILES | CCCC/C=C\CCCCCCC(=O)NC(CO)C(O)/C=C/CCCCCCCCC |
| InChI | InChI=1S/C27H51NO3/c1-3-5-7-9-11-13-15-17-19-21-23-27(31)28-25(24-29)26(30)22-20-18-16-14-12-10-8-6-4-2/h9,11,20,22,25-26,29-30H,3-8,10,12-19,21,23-24H2,1-2H3,(H,28,31)/b11-9-,22-20+ |
| InChIKey | VBIWAOBPUDVUON-WBHOQNJMSA-N |
| XLogP | 6.61 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.71 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|