C35H68NO7P — CID 138278970
[2-nonanoyloxy-3-[(9Z,12Z)-octadeca-9,12-dienoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 138278970) has the molecular formula C35H68NO7P and a molecular weight of 645.90 g/mol. Its IUPAC name is [2-nonanoyloxy-3-[(9Z,12Z)-octadeca-9,12-dienoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [2-nonanoyloxy-3-[(9Z,12Z)-octadeca-9,12-dienoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 138278970 |
| Molecular Formula | C35H68NO7P |
| Molecular Weight | 645.90 g/mol |
| Exact Mass | 645.47 |
| IUPAC Name | [2-nonanoyloxy-3-[(9Z,12Z)-octadeca-9,12-dienoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCC |
| InChI | InChI=1S/C35H68NO7P/c1-6-8-10-12-14-15-16-17-18-19-20-21-22-23-25-27-30-40-32-34(43-35(37)28-26-24-13-11-9-7-2)33-42-44(38,39)41-31-29-36(3,4)5/h14-15,17-18,34H,6-13,16,19-33H2,1-5H3/b15-14-,18-17- |
| InChIKey | VFSVWMUENLIVPK-NFYLBXPESA-N |
| XLogP | 8.69 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.90 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|