C52H94NO7P — CID 53481769
[(2R)-3-[(10Z,13Z,16Z)-docosa-10,13,16-trienoxy]-2-[(10Z,13Z,16Z)-docosa-10,13,16-trienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 53481769) has the molecular formula C52H94NO7P and a molecular weight of 876.30 g/mol. Its IUPAC name is [(2R)-3-[(10Z,13Z,16Z)-docosa-10,13,16-trienoxy]-2-[(10Z,13Z,16Z)-docosa-10,13,16-trienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-3-[(10Z,13Z,16Z)-docosa-10,13,16-trienoxy]-2-[(10Z,13Z,16Z)-docosa-10,13,16-trienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 53481769 |
| Molecular Formula | C52H94NO7P |
| Molecular Weight | 876.30 g/mol |
| Exact Mass | 875.68 |
| IUPAC Name | [(2R)-3-[(10Z,13Z,16Z)-docosa-10,13,16-trienoxy]-2-[(10Z,13Z,16Z)-docosa-10,13,16-trienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCCCCCCOC[C@H](COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCC/C=C\C/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C52H94NO7P/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-40-42-44-47-57-49-51(50-59-61(55,56)58-48-46-53(3,4)5)60-52(54)45-43-41-39-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h14-17,20-23,26-29,51H,6-13,18-19,24-25,30-50H2,1-5H3/b16-14-,17-15-,22-20-,23-21-,28-26-,29-27-/t51-/m1/s1 |
| InChIKey | QZMFOSCFDWPISC-KQHSIIGPSA-N |
| XLogP | 14.42 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 876.30 |
| LogP ≤ 5 | 14.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|