C27H50O10 — CID 138286498
[1-octanoyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] decanoate (PubChem CID 138286498) has the molecular formula C27H50O10 and a molecular weight of 534.69 g/mol. Its IUPAC name is [1-octanoyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] decanoate.
| Compound Name | [1-octanoyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] decanoate |
|---|---|
| PubChem CID | 138286498 |
| Molecular Formula | C27H50O10 |
| Molecular Weight | 534.69 g/mol |
| Exact Mass | 534.34 |
| IUPAC Name | [1-octanoyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] decanoate |
| SMILES | CCCCCCCCCC(=O)OC(COC(=O)CCCCCCC)COC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C27H50O10/c1-3-5-7-9-10-12-14-16-23(30)36-20(18-34-22(29)15-13-11-8-6-4-2)19-35-27-26(33)25(32)24(31)21(17-28)37-27/h20-21,24-28,31-33H,3-19H2,1-2H3 |
| InChIKey | WCXPRJWFABXHNK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.69 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|