C46H85NO9P+ — CID 138293782
2-[hydroxy-[2-[(5E,9Z)-8-hydroxy-10-[3-[(E)-oct-2-enyl]oxiran-2-yl]deca-5,9-dienoyl]oxy-3-[(Z)-octadec-9-enoxy]propoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 138293782) has the molecular formula C46H85NO9P+ and a molecular weight of 827.16 g/mol. Its IUPAC name is 2-[hydroxy-[2-[(5E,9Z)-8-hydroxy-10-[3-[(E)-oct-2-enyl]oxiran-2-yl]deca-5,9-dienoyl]oxy-3-[(Z)-octadec-9-enoxy]propoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[2-[(5E,9Z)-8-hydroxy-10-[3-[(E)-oct-2-enyl]oxiran-2-yl]deca-5,9-dienoyl]oxy-3-[(Z)-octadec-9-enoxy]propoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 138293782 |
| Molecular Formula | C46H85NO9P+ |
| Molecular Weight | 827.16 g/mol |
| Exact Mass | 826.60 |
| IUPAC Name | 2-[hydroxy-[2-[(5E,9Z)-8-hydroxy-10-[3-[(E)-oct-2-enyl]oxiran-2-yl]deca-5,9-dienoyl]oxy-3-[(Z)-octadec-9-enoxy]propoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCC/C=C/CC1OC1/C=C\C(O)C/C=C/CCCC(=O)OC(COCCCCCCCC/C=C\CCCCCCCC)COP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C46H84NO9P/c1-6-8-10-12-14-15-16-17-18-19-20-21-22-23-27-31-38-52-40-43(41-54-57(50,51)53-39-37-47(3,4)5)55-46(49)34-30-26-25-28-32-42(48)35-36-45-44(56-45)33-29-24-13-11-9-7-2/h17-18,24-25,28-29,35-36,42-45,48H,6-16,19-23,26-27,30-34,37-41H2,1-5H3/p+1/b18-17-,28-25+,29-24+,36-35- |
| InChIKey | WZWWTZNFVRPTSM-GPGIEMNTSA-O |
| XLogP | 11.12 |
| TPSA | 124.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.16 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|