About triethoxysilane
triethoxysilane (PubChem CID 13830) has the molecular formula C6H16O3Si
and a molecular weight of 164.28 g/mol. Its IUPAC name is triethoxysilane.
Molecular Properties
| Compound Name | triethoxysilane |
| PubChem CID | 13830 |
| Molecular Formula | C6H16O3Si |
| Molecular Weight | 164.28 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | triethoxysilane |
| SMILES | CCO[SiH](OCC)OCC |
| InChI | InChI=1S/C6H16O3Si/c1-4-7-10(8-5-2)9-6-3/h10H,4-6H2,1-3H3 |
| InChIKey | QQQSFSZALRVCSZ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.28 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze triethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethoxysilane?
The IUPAC name of triethoxysilane (CID 13830) is triethoxysilane.
What is the SMILES notation for triethoxysilane?
The canonical SMILES for triethoxysilane is CCO[SiH](OCC)OCC.
What is the InChIKey of triethoxysilane?
The InChIKey is QQQSFSZALRVCSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16O3Si/c1-4-7-10(8-5-2)9-6-3/h10H,4-6H2,1-3H3.
What are the key properties of triethoxysilane?
triethoxysilane has a molecular weight of 164.28 g/mol, XLogP of 0.81, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for triethoxysilane is sourced from PubChem (CID 13830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).