C38H65O8P — CID 138303237
[1-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxy-3-[hydroxy(methoxy)phosphoryl]oxypropan-2-yl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate (PubChem CID 138303237) has the molecular formula C38H65O8P and a molecular weight of 680.90 g/mol. Its IUPAC name is [1-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxy-3-[hydroxy(methoxy)phosphoryl]oxypropan-2-yl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate.
| Compound Name | [1-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxy-3-[hydroxy(methoxy)phosphoryl]oxypropan-2-yl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 138303237 |
| Molecular Formula | C38H65O8P |
| Molecular Weight | 680.90 g/mol |
| Exact Mass | 680.44 |
| IUPAC Name | [1-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxy-3-[hydroxy(methoxy)phosphoryl]oxypropan-2-yl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OC(COC(=O)CCCCCCC/C=C\C/C=C\CCC)COP(=O)(O)OC |
| InChI | InChI=1S/C38H65O8P/c1-4-6-8-10-12-14-16-18-19-21-23-25-27-29-31-33-38(40)46-36(35-45-47(41,42)43-3)34-44-37(39)32-30-28-26-24-22-20-17-15-13-11-9-7-5-2/h6,8-9,11-12,14-15,17-19,36H,4-5,7,10,13,16,20-35H2,1-3H3,(H,41,42)/b8-6-,11-9-,14-12-,17-15-,19-18- |
| InChIKey | YCYSHCAXYATMFI-MMPHRCTASA-N |
| XLogP | 10.83 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.90 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|