C41H78N2O6P+ — CID 138316111
2-[hydroxy-[(4E,8E,12E)-3-hydroxy-2-[[(Z)-octadec-11-enoyl]amino]octadeca-4,8,12-trienoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 138316111) has the molecular formula C41H78N2O6P+ and a molecular weight of 726.06 g/mol. Its IUPAC name is 2-[hydroxy-[(4E,8E,12E)-3-hydroxy-2-[[(Z)-octadec-11-enoyl]amino]octadeca-4,8,12-trienoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[(4E,8E,12E)-3-hydroxy-2-[[(Z)-octadec-11-enoyl]amino]octadeca-4,8,12-trienoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 138316111 |
| Molecular Formula | C41H78N2O6P+ |
| Molecular Weight | 726.06 g/mol |
| Exact Mass | 725.56 |
| IUPAC Name | 2-[hydroxy-[(4E,8E,12E)-3-hydroxy-2-[[(Z)-octadec-11-enoyl]amino]octadeca-4,8,12-trienoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCC/C=C/CC/C=C/CC/C=C/C(O)C(COP(=O)(O)OCC[N+](C)(C)C)NC(=O)CCCCCCCCC/C=C\CCCCCC |
| InChI | InChI=1S/C41H77N2O6P/c1-6-8-10-12-14-16-18-20-21-23-25-27-29-31-33-35-41(45)42-39(38-49-50(46,47)48-37-36-43(3,4)5)40(44)34-32-30-28-26-24-22-19-17-15-13-11-9-7-2/h15-18,24,26,32,34,39-40,44H,6-14,19-23,25,27-31,33,35-38H2,1-5H3,(H-,42,45,46,47)/p+1/b17-15+,18-16-,26-24+,34-32+ |
| InChIKey | ZRBLKGPWJCPEHV-YYFWXGIVSA-O |
| XLogP | 10.52 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.06 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|