C26H29ClN2O5S — CID 138320066
(3S,4'Z)-6-chloro-11',11'-dioxospiro[1,2-dihydroindene-3,20'-8,18-dioxa-11λ6-thia-1,12-diazatricyclo[12.7.2.017,22]tricosa-4,14(23),15,17(22)-tetraene]-13'-one (PubChem CID 138320066) has the molecular formula C26H29ClN2O5S and a molecular weight of 517.05 g/mol. Its IUPAC name is (3S,4'Z)-6-chloro-11',11'-dioxospiro[1,2-dihydroindene-3,20'-8,18-dioxa-11λ6-thia-1,12-diazatricyclo[12.7.2.017,22]tricosa-4,14(23),15,17(22)-tetraene]-13'-one.
| Compound Name | (3S,4'Z)-6-chloro-11',11'-dioxospiro[1,2-dihydroindene-3,20'-8,18-dioxa-11λ6-thia-1,12-diazatricyclo[12.7.2.017,22]tricosa-4,14(23),15,17(22)-tetraene]-13'-one |
|---|---|
| PubChem CID | 138320066 |
| Molecular Formula | C26H29ClN2O5S |
| Molecular Weight | 517.05 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | (3S,4'Z)-6-chloro-11',11'-dioxospiro[1,2-dihydroindene-3,20'-8,18-dioxa-11λ6-thia-1,12-diazatricyclo[12.7.2.017,22]tricosa-4,14(23),15,17(22)-tetraene]-13'-one |
| SMILES | O=C1NS(=O)(=O)CCOCC/C=C\CCN2C[C@@]3(CCc4cc(Cl)ccc43)COc3ccc1cc32 |
| InChI | InChI=1S/C26H29ClN2O5S/c27-21-6-7-22-19(15-21)9-10-26(22)17-29-11-3-1-2-4-12-33-13-14-35(31,32)28-25(30)20-5-8-24(34-18-26)23(29)16-20/h1-2,5-8,15-16H,3-4,9-14,17-18H2,(H,28,30)/b2-1-/t26-/m0/s1 |
| InChIKey | FXFAQBXWILEZHM-XJJVJZOFSA-N |
| XLogP | 3.85 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.05 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|