C14H27NO7 — CID 138373878
methyl 6-[[(2S,3R,4S,5R)-2,3,4,5-tetrahydroxyheptanoyl]amino]hexanoate (PubChem CID 138373878) has the molecular formula C14H27NO7 and a molecular weight of 321.37 g/mol. Its IUPAC name is methyl 6-[[(2S,3R,4S,5R)-2,3,4,5-tetrahydroxyheptanoyl]amino]hexanoate.
| Compound Name | methyl 6-[[(2S,3R,4S,5R)-2,3,4,5-tetrahydroxyheptanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 138373878 |
| Molecular Formula | C14H27NO7 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | methyl 6-[[(2S,3R,4S,5R)-2,3,4,5-tetrahydroxyheptanoyl]amino]hexanoate |
| SMILES | CC[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)C(=O)NCCCCCC(=O)OC |
| InChI | InChI=1S/C14H27NO7/c1-3-9(16)11(18)12(19)13(20)14(21)15-8-6-4-5-7-10(17)22-2/h9,11-13,16,18-20H,3-8H2,1-2H3,(H,15,21)/t9-,11+,12-,13+/m1/s1 |
| InChIKey | APDLMHGRLRLMMC-MGAJPHDKSA-N |
| XLogP | -1.31 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|