C10H10BrClO2 — CID 138376214
2-(3-bromo-4-chlorophenyl)-2-methyl-1,3-dioxolane (PubChem CID 138376214) has the molecular formula C10H10BrClO2 and a molecular weight of 277.54 g/mol. Its IUPAC name is 2-(3-bromo-4-chlorophenyl)-2-methyl-1,3-dioxolane.
| Compound Name | 2-(3-bromo-4-chlorophenyl)-2-methyl-1,3-dioxolane |
|---|---|
| PubChem CID | 138376214 |
| Molecular Formula | C10H10BrClO2 |
| Molecular Weight | 277.54 g/mol |
| Exact Mass | 275.96 |
| IUPAC Name | 2-(3-bromo-4-chlorophenyl)-2-methyl-1,3-dioxolane |
| SMILES | CC1(c2ccc(Cl)c(Br)c2)OCCO1 |
| InChI | InChI=1S/C10H10BrClO2/c1-10(13-4-5-14-10)7-2-3-9(12)8(11)6-7/h2-3,6H,4-5H2,1H3 |
| InChIKey | LYWGFGVTWLQMKT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |