C13H10Cl2N2O3S — CID 138377042
ethyl 3-[(4,5-dichloro-1,2-thiazole-3-carbonyl)amino]benzoate (PubChem CID 138377042) has the molecular formula C13H10Cl2N2O3S and a molecular weight of 345.21 g/mol. Its IUPAC name is ethyl 3-[(4,5-dichloro-1,2-thiazole-3-carbonyl)amino]benzoate.
| Compound Name | ethyl 3-[(4,5-dichloro-1,2-thiazole-3-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 138377042 |
| Molecular Formula | C13H10Cl2N2O3S |
| Molecular Weight | 345.21 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | ethyl 3-[(4,5-dichloro-1,2-thiazole-3-carbonyl)amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)c2nsc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C13H10Cl2N2O3S/c1-2-20-13(19)7-4-3-5-8(6-7)16-12(18)10-9(14)11(15)21-17-10/h3-6H,2H2,1H3,(H,16,18) |
| InChIKey | QURWLSWQZKPDHD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.21 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |