About N-(benzimidazol-1-yl)-2,4-dichloro-5-sulfamoylbenzamide
N-(benzimidazol-1-yl)-2,4-dichloro-5-sulfamoylbenzamide (PubChem CID 138377179) has the molecular formula C14H10Cl2N4O3S
and a molecular weight of 385.23 g/mol. Its IUPAC name is N-(benzimidazol-1-yl)-2,4-dichloro-5-sulfamoylbenzamide.
Molecular Properties
| Compound Name | N-(benzimidazol-1-yl)-2,4-dichloro-5-sulfamoylbenzamide |
| PubChem CID | 138377179 |
| Molecular Formula | C14H10Cl2N4O3S |
| Molecular Weight | 385.23 g/mol |
| Exact Mass | 383.99 |
| IUPAC Name | N-(benzimidazol-1-yl)-2,4-dichloro-5-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1cc(C(=O)Nn2cnc3ccccc32)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H10Cl2N4O3S/c15-9-6-10(16)13(24(17,22)23)5-8(9)14(21)19-20-7-18-11-3-1-2-4-12(11)20/h1-7H,(H,19,21)(H2,17,22,23) |
| InChIKey | AKBIFIJQRGIDLH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.23 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(benzimidazol-1-yl)-2,4-dichloro-5-sulfamoylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(benzimidazol-1-yl)-2,4-dichloro-5-sulfamoylbenzamide?
The IUPAC name of N-(benzimidazol-1-yl)-2,4-dichloro-5-sulfamoylbenzamide (CID 138377179) is N-(benzimidazol-1-yl)-2,4-dichloro-5-sulfamoylbenzamide.
What is the SMILES notation for N-(benzimidazol-1-yl)-2,4-dichloro-5-sulfamoylbenzamide?
The canonical SMILES for N-(benzimidazol-1-yl)-2,4-dichloro-5-sulfamoylbenzamide is NS(=O)(=O)c1cc(C(=O)Nn2cnc3ccccc32)c(Cl)cc1Cl.
What is the InChIKey of N-(benzimidazol-1-yl)-2,4-dichloro-5-sulfamoylbenzamide?
The InChIKey is AKBIFIJQRGIDLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10Cl2N4O3S/c15-9-6-10(16)13(24(17,22)23)5-8(9)14(21)19-20-7-18-11-3-1-2-4-12(11)20/h1-7H,(H,19,21)(H2,17,22,23).
What are the key properties of N-(benzimidazol-1-yl)-2,4-dichloro-5-sulfamoylbenzamide?
N-(benzimidazol-1-yl)-2,4-dichloro-5-sulfamoylbenzamide has a molecular weight of 385.23 g/mol, XLogP of 2.37, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(benzimidazol-1-yl)-2,4-dichloro-5-sulfamoylbenzamide is sourced from PubChem (CID 138377179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).