C25H16FNO3S — CID 138377375
2-(4-fluorophenyl)sulfanyl-3-(4-methoxy-1H-indol-3-yl)naphthalene-1,4-dione (PubChem CID 138377375) has the molecular formula C25H16FNO3S and a molecular weight of 429.47 g/mol. Its IUPAC name is 2-(4-fluorophenyl)sulfanyl-3-(4-methoxy-1H-indol-3-yl)naphthalene-1,4-dione.
| Compound Name | 2-(4-fluorophenyl)sulfanyl-3-(4-methoxy-1H-indol-3-yl)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 138377375 |
| Molecular Formula | C25H16FNO3S |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | 2-(4-fluorophenyl)sulfanyl-3-(4-methoxy-1H-indol-3-yl)naphthalene-1,4-dione |
| SMILES | COc1cccc2[nH]cc(C3=C(Sc4ccc(F)cc4)C(=O)c4ccccc4C3=O)c12 |
| InChI | InChI=1S/C25H16FNO3S/c1-30-20-8-4-7-19-21(20)18(13-27-19)22-23(28)16-5-2-3-6-17(16)24(29)25(22)31-15-11-9-14(26)10-12-15/h2-13,27H,1H3 |
| InChIKey | TXMMROXIJSMXNV-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|