C19H21N5O2S — CID 138380305
N-methyl-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-2-pyridin-4-yl-4,5,6,7-tetrahydro-1,3-benzothiazole-5-carboxamide (PubChem CID 138380305) has the molecular formula C19H21N5O2S and a molecular weight of 383.48 g/mol. Its IUPAC name is N-methyl-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-2-pyridin-4-yl-4,5,6,7-tetrahydro-1,3-benzothiazole-5-carboxamide.
| Compound Name | N-methyl-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-2-pyridin-4-yl-4,5,6,7-tetrahydro-1,3-benzothiazole-5-carboxamide |
|---|---|
| PubChem CID | 138380305 |
| Molecular Formula | C19H21N5O2S |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | N-methyl-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-2-pyridin-4-yl-4,5,6,7-tetrahydro-1,3-benzothiazole-5-carboxamide |
| SMILES | Cc1nc(CCN(C)C(=O)C2CCc3sc(-c4ccncc4)nc3C2)no1 |
| InChI | InChI=1S/C19H21N5O2S/c1-12-21-17(23-26-12)7-10-24(2)19(25)14-3-4-16-15(11-14)22-18(27-16)13-5-8-20-9-6-13/h5-6,8-9,14H,3-4,7,10-11H2,1-2H3 |
| InChIKey | WMQLEMAAVGARPY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 85.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |