C20H23N5OS — CID 138383058
N-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-2-pyridin-4-yl-4,5,6,7-tetrahydro-1,3-benzothiazole-5-carboxamide (PubChem CID 138383058) has the molecular formula C20H23N5OS and a molecular weight of 381.51 g/mol. Its IUPAC name is N-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-2-pyridin-4-yl-4,5,6,7-tetrahydro-1,3-benzothiazole-5-carboxamide.
| Compound Name | N-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-2-pyridin-4-yl-4,5,6,7-tetrahydro-1,3-benzothiazole-5-carboxamide |
|---|---|
| PubChem CID | 138383058 |
| Molecular Formula | C20H23N5OS |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | N-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-2-pyridin-4-yl-4,5,6,7-tetrahydro-1,3-benzothiazole-5-carboxamide |
| SMILES | Cc1cc(C)n(CCNC(=O)C2CCc3sc(-c4ccncc4)nc3C2)n1 |
| InChI | InChI=1S/C20H23N5OS/c1-13-11-14(2)25(24-13)10-9-22-19(26)16-3-4-18-17(12-16)23-20(27-18)15-5-7-21-8-6-15/h5-8,11,16H,3-4,9-10,12H2,1-2H3,(H,22,26) |
| InChIKey | HPRLOZFSARZBMW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |