C20H25ClN4OS — CID 154921909
[(1R,5S)-8-amino-3-azabicyclo[3.2.1]octan-3-yl]-(2-pyridin-4-yl-4,5,6,7-tetrahydro-1,3-benzothiazol-5-yl)methanone;hydrochloride (PubChem CID 154921909) has the molecular formula C20H25ClN4OS and a molecular weight of 404.97 g/mol. Its IUPAC name is [(1R,5S)-8-amino-3-azabicyclo[3.2.1]octan-3-yl]-(2-pyridin-4-yl-4,5,6,7-tetrahydro-1,3-benzothiazol-5-yl)methanone;hydrochloride.
| Compound Name | [(1R,5S)-8-amino-3-azabicyclo[3.2.1]octan-3-yl]-(2-pyridin-4-yl-4,5,6,7-tetrahydro-1,3-benzothiazol-5-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 154921909 |
| Molecular Formula | C20H25ClN4OS |
| Molecular Weight | 404.97 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | [(1R,5S)-8-amino-3-azabicyclo[3.2.1]octan-3-yl]-(2-pyridin-4-yl-4,5,6,7-tetrahydro-1,3-benzothiazol-5-yl)methanone;hydrochloride |
| SMILES | Cl.NC1[C@@H]2CC[C@H]1CN(C(=O)C1CCc3sc(-c4ccncc4)nc3C1)C2 |
| InChI | InChI=1S/C20H24N4OS.ClH/c21-18-14-1-2-15(18)11-24(10-14)20(25)13-3-4-17-16(9-13)23-19(26-17)12-5-7-22-8-6-12;/h5-8,13-15,18H,1-4,9-11,21H2;1H/t13?,14-,15+,18?; |
| InChIKey | ZEAIIMNRONLERY-QGDHZHAGSA-N |
| XLogP | 2.93 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.97 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |