C19H27N3O2 — CID 138382775
4-[(1-methyl-6-oxopiperidin-3-yl)methyl]-1-[(3-methylphenyl)methyl]piperazin-2-one (PubChem CID 138382775) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is 4-[(1-methyl-6-oxopiperidin-3-yl)methyl]-1-[(3-methylphenyl)methyl]piperazin-2-one.
| Compound Name | 4-[(1-methyl-6-oxopiperidin-3-yl)methyl]-1-[(3-methylphenyl)methyl]piperazin-2-one |
|---|---|
| PubChem CID | 138382775 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 4-[(1-methyl-6-oxopiperidin-3-yl)methyl]-1-[(3-methylphenyl)methyl]piperazin-2-one |
| SMILES | Cc1cccc(CN2CCN(CC3CCC(=O)N(C)C3)CC2=O)c1 |
| InChI | InChI=1S/C19H27N3O2/c1-15-4-3-5-16(10-15)13-22-9-8-21(14-19(22)24)12-17-6-7-18(23)20(2)11-17/h3-5,10,17H,6-9,11-14H2,1-2H3 |
| InChIKey | TZZACKOBAXEBLH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |