C16H18N6O2S2 — CID 138384975
N-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-2-(3,5-dimethyl-1,2-oxazol-4-yl)-4,5,6,7-tetrahydro-1,3-benzothiazole-5-carboxamide (PubChem CID 138384975) has the molecular formula C16H18N6O2S2 and a molecular weight of 390.49 g/mol. Its IUPAC name is N-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-2-(3,5-dimethyl-1,2-oxazol-4-yl)-4,5,6,7-tetrahydro-1,3-benzothiazole-5-carboxamide.
| Compound Name | N-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-2-(3,5-dimethyl-1,2-oxazol-4-yl)-4,5,6,7-tetrahydro-1,3-benzothiazole-5-carboxamide |
|---|---|
| PubChem CID | 138384975 |
| Molecular Formula | C16H18N6O2S2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | N-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-2-(3,5-dimethyl-1,2-oxazol-4-yl)-4,5,6,7-tetrahydro-1,3-benzothiazole-5-carboxamide |
| SMILES | Cc1noc(C)c1-c1nc2c(s1)CCC(C(=O)NCc1nnc(N)s1)C2 |
| InChI | InChI=1S/C16H18N6O2S2/c1-7-13(8(2)24-22-7)15-19-10-5-9(3-4-11(10)25-15)14(23)18-6-12-20-21-16(17)26-12/h9H,3-6H2,1-2H3,(H2,17,21)(H,18,23) |
| InChIKey | NLJPEFGNGKWGSN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 119.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |