C21H23N3O3S — CID 138381509
2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[[3-(hydroxymethyl)phenyl]methyl]-4,5,6,7-tetrahydro-1,3-benzothiazole-5-carboxamide (PubChem CID 138381509) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[[3-(hydroxymethyl)phenyl]methyl]-4,5,6,7-tetrahydro-1,3-benzothiazole-5-carboxamide.
| Compound Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[[3-(hydroxymethyl)phenyl]methyl]-4,5,6,7-tetrahydro-1,3-benzothiazole-5-carboxamide |
|---|---|
| PubChem CID | 138381509 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[[3-(hydroxymethyl)phenyl]methyl]-4,5,6,7-tetrahydro-1,3-benzothiazole-5-carboxamide |
| SMILES | Cc1noc(C)c1-c1nc2c(s1)CCC(C(=O)NCc1cccc(CO)c1)C2 |
| InChI | InChI=1S/C21H23N3O3S/c1-12-19(13(2)27-24-12)21-23-17-9-16(6-7-18(17)28-21)20(26)22-10-14-4-3-5-15(8-14)11-25/h3-5,8,16,25H,6-7,9-11H2,1-2H3,(H,22,26) |
| InChIKey | WEKQYDDFAVQPJD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |