C21H30N2O2 — CID 138385577
oxolan-2-yl-[4-[(E)-2-phenylpent-2-enyl]-1,4-diazepan-1-yl]methanone (PubChem CID 138385577) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is oxolan-2-yl-[4-[(E)-2-phenylpent-2-enyl]-1,4-diazepan-1-yl]methanone.
| Compound Name | oxolan-2-yl-[4-[(E)-2-phenylpent-2-enyl]-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 138385577 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | oxolan-2-yl-[4-[(E)-2-phenylpent-2-enyl]-1,4-diazepan-1-yl]methanone |
| SMILES | CC/C=C(/CN1CCCN(C(=O)C2CCCO2)CC1)c1ccccc1 |
| InChI | InChI=1S/C21H30N2O2/c1-2-8-19(18-9-4-3-5-10-18)17-22-12-7-13-23(15-14-22)21(24)20-11-6-16-25-20/h3-5,8-10,20H,2,6-7,11-17H2,1H3/b19-8- |
| InChIKey | MLHZYZDETVMKCS-UWVJOHFNSA-N |
| XLogP | 3.19 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |