C11H19F3N2O — CID 138387046
[5-(4,4,4-trifluorobutyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3a-yl]methanol (PubChem CID 138387046) has the molecular formula C11H19F3N2O and a molecular weight of 252.28 g/mol. Its IUPAC name is [5-(4,4,4-trifluorobutyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3a-yl]methanol.
| Compound Name | [5-(4,4,4-trifluorobutyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3a-yl]methanol |
|---|---|
| PubChem CID | 138387046 |
| Molecular Formula | C11H19F3N2O |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | [5-(4,4,4-trifluorobutyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3a-yl]methanol |
| SMILES | OCC12CNCC1CN(CCCC(F)(F)F)C2 |
| InChI | InChI=1S/C11H19F3N2O/c12-11(13,14)2-1-3-16-5-9-4-15-6-10(9,7-16)8-17/h9,15,17H,1-8H2 |
| InChIKey | NNDSKANZAZUTMO-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |