C15H27F3N2O5 — CID 154923989
acetic acid;[5-(4,4,4-trifluorobutyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3a-yl]methanol (PubChem CID 154923989) has the molecular formula C15H27F3N2O5 and a molecular weight of 372.38 g/mol. Its IUPAC name is acetic acid;[5-(4,4,4-trifluorobutyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3a-yl]methanol.
| Compound Name | acetic acid;[5-(4,4,4-trifluorobutyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3a-yl]methanol |
|---|---|
| PubChem CID | 154923989 |
| Molecular Formula | C15H27F3N2O5 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | acetic acid;[5-(4,4,4-trifluorobutyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3a-yl]methanol |
| SMILES | CC(=O)O.CC(=O)O.OCC12CNCC1CN(CCCC(F)(F)F)C2 |
| InChI | InChI=1S/C11H19F3N2O.2C2H4O2/c12-11(13,14)2-1-3-16-5-9-4-15-6-10(9,7-16)8-17;2*1-2(3)4/h9,15,17H,1-8H2;2*1H3,(H,3,4) |
| InChIKey | BDHPPGHZXLLUKS-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |