C13H14ClN3O3 — CID 138389083
5-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-4-imino-1-methylimidazolidin-2-one (PubChem CID 138389083) has the molecular formula C13H14ClN3O3 and a molecular weight of 295.73 g/mol. Its IUPAC name is 5-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-4-imino-1-methylimidazolidin-2-one.
| Compound Name | 5-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-4-imino-1-methylimidazolidin-2-one |
|---|---|
| PubChem CID | 138389083 |
| Molecular Formula | C13H14ClN3O3 |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 5-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-4-imino-1-methylimidazolidin-2-one |
| SMILES | [H]/N=C1\NC(=O)N(C)C1c1cc(Cl)c2c(c1)OCCCO2 |
| InChI | InChI=1S/C13H14ClN3O3/c1-17-10(12(15)16-13(17)18)7-5-8(14)11-9(6-7)19-3-2-4-20-11/h5-6,10H,2-4H2,1H3,(H2,15,16,18) |
| InChIKey | WVUWFKYBHDGZPT-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|