C21H19ClN2O5 — CID 41096525
(4R)-3'-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 41096525) has the molecular formula C21H19ClN2O5 and a molecular weight of 414.85 g/mol. Its IUPAC name is (4R)-3'-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | (4R)-3'-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 41096525 |
| Molecular Formula | C21H19ClN2O5 |
| Molecular Weight | 414.85 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | (4R)-3'-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1N[C@@]2(CCOc3ccccc32)C(=O)N1Cc1cc(Cl)c2c(c1)OCCCO2 |
| InChI | InChI=1S/C21H19ClN2O5/c22-15-10-13(11-17-18(15)29-8-3-7-27-17)12-24-19(25)21(23-20(24)26)6-9-28-16-5-2-1-4-14(16)21/h1-2,4-5,10-11H,3,6-9,12H2,(H,23,26)/t21-/m1/s1 |
| InChIKey | YPIVPXXWKXVJEA-OAQYLSRUSA-N |
| XLogP | 3.23 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.85 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|