C19H17FN2O4 — CID 4883616
3'-[(3-fluoro-4-methoxyphenyl)methyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 4883616) has the molecular formula C19H17FN2O4 and a molecular weight of 356.35 g/mol. Its IUPAC name is 3'-[(3-fluoro-4-methoxyphenyl)methyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | 3'-[(3-fluoro-4-methoxyphenyl)methyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 4883616 |
| Molecular Formula | C19H17FN2O4 |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 3'-[(3-fluoro-4-methoxyphenyl)methyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | COc1ccc(CN2C(=O)NC3(CCOc4ccccc43)C2=O)cc1F |
| InChI | InChI=1S/C19H17FN2O4/c1-25-16-7-6-12(10-14(16)20)11-22-17(23)19(21-18(22)24)8-9-26-15-5-3-2-4-13(15)19/h2-7,10H,8-9,11H2,1H3,(H,21,24) |
| InChIKey | WVXGCYYMIMQAOC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|