C22H23BrN2O5 — CID 41096337
(4R)-3'-[(2-bromo-4,5-diethoxyphenyl)methyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 41096337) has the molecular formula C22H23BrN2O5 and a molecular weight of 475.34 g/mol. Its IUPAC name is (4R)-3'-[(2-bromo-4,5-diethoxyphenyl)methyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | (4R)-3'-[(2-bromo-4,5-diethoxyphenyl)methyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 41096337 |
| Molecular Formula | C22H23BrN2O5 |
| Molecular Weight | 475.34 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | (4R)-3'-[(2-bromo-4,5-diethoxyphenyl)methyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | CCOc1cc(Br)c(CN2C(=O)N[C@@]3(CCOc4ccccc43)C2=O)cc1OCC |
| InChI | InChI=1S/C22H23BrN2O5/c1-3-28-18-11-14(16(23)12-19(18)29-4-2)13-25-20(26)22(24-21(25)27)9-10-30-17-8-6-5-7-15(17)22/h5-8,11-12H,3-4,9-10,13H2,1-2H3,(H,24,27)/t22-/m1/s1 |
| InChIKey | AKJNLGPCHBSMKK-JOCHJYFZSA-N |
| XLogP | 3.98 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|