C15H20N2O3Si — CID 99804409
(4R)-3'-(trimethylsilylmethyl)spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 99804409) has the molecular formula C15H20N2O3Si and a molecular weight of 304.42 g/mol. Its IUPAC name is (4R)-3'-(trimethylsilylmethyl)spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | (4R)-3'-(trimethylsilylmethyl)spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 99804409 |
| Molecular Formula | C15H20N2O3Si |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | (4R)-3'-(trimethylsilylmethyl)spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | C[Si](C)(C)CN1C(=O)N[C@@]2(CCOc3ccccc32)C1=O |
| InChI | InChI=1S/C15H20N2O3Si/c1-21(2,3)10-17-13(18)15(16-14(17)19)8-9-20-12-7-5-4-6-11(12)15/h4-7H,8-10H2,1-3H3,(H,16,19)/t15-/m1/s1 |
| InChIKey | KIUWVWXOGJZKRT-OAHLLOKOSA-N |
| XLogP | 2.09 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|