C14H11ClN4O3S — CID 9450202
(4S)-3'-[(5-chlorothiadiazol-4-yl)methyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 9450202) has the molecular formula C14H11ClN4O3S and a molecular weight of 350.79 g/mol. Its IUPAC name is (4S)-3'-[(5-chlorothiadiazol-4-yl)methyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | (4S)-3'-[(5-chlorothiadiazol-4-yl)methyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 9450202 |
| Molecular Formula | C14H11ClN4O3S |
| Molecular Weight | 350.79 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | (4S)-3'-[(5-chlorothiadiazol-4-yl)methyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1N[C@]2(CCOc3ccccc32)C(=O)N1Cc1nnsc1Cl |
| InChI | InChI=1S/C14H11ClN4O3S/c15-11-9(17-18-23-11)7-19-12(20)14(16-13(19)21)5-6-22-10-4-2-1-3-8(10)14/h1-4H,5-7H2,(H,16,21)/t14-/m0/s1 |
| InChIKey | GCOYBUJDGKMTMO-AWEZNQCLSA-N |
| XLogP | 1.92 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.79 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|