C19H16N6O3 — CID 41154747
(4R)-3'-[(1-phenyltetrazol-5-yl)methyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 41154747) has the molecular formula C19H16N6O3 and a molecular weight of 376.38 g/mol. Its IUPAC name is (4R)-3'-[(1-phenyltetrazol-5-yl)methyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | (4R)-3'-[(1-phenyltetrazol-5-yl)methyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 41154747 |
| Molecular Formula | C19H16N6O3 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | (4R)-3'-[(1-phenyltetrazol-5-yl)methyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1N[C@@]2(CCOc3ccccc32)C(=O)N1Cc1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C19H16N6O3/c26-17-19(10-11-28-15-9-5-4-8-14(15)19)20-18(27)24(17)12-16-21-22-23-25(16)13-6-2-1-3-7-13/h1-9H,10-12H2,(H,20,27)/t19-/m1/s1 |
| InChIKey | PFZHNDOJHUMDFU-LJQANCHMSA-N |
| XLogP | 1.39 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|