C14H16F3N3O — CID 138389199
4-imino-1-(2-methylpropyl)-5-[3-(trifluoromethyl)phenyl]imidazolidin-2-one (PubChem CID 138389199) has the molecular formula C14H16F3N3O and a molecular weight of 299.30 g/mol. Its IUPAC name is 4-imino-1-(2-methylpropyl)-5-[3-(trifluoromethyl)phenyl]imidazolidin-2-one.
| Compound Name | 4-imino-1-(2-methylpropyl)-5-[3-(trifluoromethyl)phenyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 138389199 |
| Molecular Formula | C14H16F3N3O |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 4-imino-1-(2-methylpropyl)-5-[3-(trifluoromethyl)phenyl]imidazolidin-2-one |
| SMILES | [H]/N=C1\NC(=O)N(CC(C)C)C1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H16F3N3O/c1-8(2)7-20-11(12(18)19-13(20)21)9-4-3-5-10(6-9)14(15,16)17/h3-6,8,11H,7H2,1-2H3,(H2,18,19,21) |
| InChIKey | YETAUTPKCOPWLI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 56.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|