C14H9ClF2N2O — CID 138391833
(1Z)-N,2-bis(4-fluorophenyl)-2-oxoethanehydrazonoyl chloride (PubChem CID 138391833) has the molecular formula C14H9ClF2N2O and a molecular weight of 294.69 g/mol. Its IUPAC name is (1Z)-N,2-bis(4-fluorophenyl)-2-oxoethanehydrazonoyl chloride.
| Compound Name | (1Z)-N,2-bis(4-fluorophenyl)-2-oxoethanehydrazonoyl chloride |
|---|---|
| PubChem CID | 138391833 |
| Molecular Formula | C14H9ClF2N2O |
| Molecular Weight | 294.69 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | (1Z)-N,2-bis(4-fluorophenyl)-2-oxoethanehydrazonoyl chloride |
| SMILES | O=C(/C(Cl)=N/Nc1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H9ClF2N2O/c15-14(13(20)9-1-3-10(16)4-2-9)19-18-12-7-5-11(17)6-8-12/h1-8,18H/b19-14- |
| InChIKey | CLQWTJREUZNBDX-RGEXLXHISA-N |
| XLogP | 3.81 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.69 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|