(1Z)-N,2-bis(4-fluorophenyl)-2-oxoethanehydrazonoyl chloride

C14H9ClF2N2O — CID 138391833

IUPAC(1Z)-N,2-bis(4-fluorophenyl)-2-oxoethanehydrazonoyl chloride
SMILESO=C(/C(Cl)=N/Nc1ccc(F)cc1)c1ccc(F)cc1
InChIInChI=1S/C14H9ClF2N2O/c15-14(13(20)9-1-3-10(16)4-2-9)19-18-12-7-5-11(17)6-8-12/h1-8,18H/b19-14-
InChIKeyCLQWTJREUZNBDX-RGEXLXHISA-N
MW294.69 g/mol
LogP3.81
Rot. Bonds4

About (1Z)-N,2-bis(4-fluorophenyl)-2-oxoethanehydrazonoyl chloride

(1Z)-N,2-bis(4-fluorophenyl)-2-oxoethanehydrazonoyl chloride (PubChem CID 138391833) has the molecular formula C14H9ClF2N2O and a molecular weight of 294.69 g/mol. Its IUPAC name is (1Z)-N,2-bis(4-fluorophenyl)-2-oxoethanehydrazonoyl chloride.

Molecular Properties

Compound Name(1Z)-N,2-bis(4-fluorophenyl)-2-oxoethanehydrazonoyl chloride
PubChem CID138391833
Molecular FormulaC14H9ClF2N2O
Molecular Weight294.69 g/mol
Exact Mass294.04
IUPAC Name(1Z)-N,2-bis(4-fluorophenyl)-2-oxoethanehydrazonoyl chloride
SMILESO=C(/C(Cl)=N/Nc1ccc(F)cc1)c1ccc(F)cc1
InChIInChI=1S/C14H9ClF2N2O/c15-14(13(20)9-1-3-10(16)4-2-9)19-18-12-7-5-11(17)6-8-12/h1-8,18H/b19-14-
InChIKeyCLQWTJREUZNBDX-RGEXLXHISA-N
XLogP3.81
TPSA41.46 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500294.69
LogP ≤ 53.81
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze (1Z)-N,2-bis(4-fluorophenyl)-2-oxoethanehydrazonoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1Z)-N,2-bis(4-fluorophenyl)-2-oxoethanehydrazonoyl chloride?
The IUPAC name of (1Z)-N,2-bis(4-fluorophenyl)-2-oxoethanehydrazonoyl chloride (CID 138391833) is (1Z)-N,2-bis(4-fluorophenyl)-2-oxoethanehydrazonoyl chloride.
What is the SMILES notation for (1Z)-N,2-bis(4-fluorophenyl)-2-oxoethanehydrazonoyl chloride?
The canonical SMILES for (1Z)-N,2-bis(4-fluorophenyl)-2-oxoethanehydrazonoyl chloride is O=C(/C(Cl)=N/Nc1ccc(F)cc1)c1ccc(F)cc1.
What is the InChIKey of (1Z)-N,2-bis(4-fluorophenyl)-2-oxoethanehydrazonoyl chloride?
The InChIKey is CLQWTJREUZNBDX-RGEXLXHISA-N. The full InChI is InChI=1S/C14H9ClF2N2O/c15-14(13(20)9-1-3-10(16)4-2-9)19-18-12-7-5-11(17)6-8-12/h1-8,18H/b19-14-.
What are the key properties of (1Z)-N,2-bis(4-fluorophenyl)-2-oxoethanehydrazonoyl chloride?
(1Z)-N,2-bis(4-fluorophenyl)-2-oxoethanehydrazonoyl chloride has a molecular weight of 294.69 g/mol, XLogP of 3.81, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-N,2-bis(4-fluorophenyl)-2-oxoethanehydrazonoyl chloride is sourced from PubChem (CID 138391833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).