C12H12ClFN2O — CID 10848582
2-chloro-2-(1,3-diazinan-2-ylidene)-1-(4-fluorophenyl)ethanone (PubChem CID 10848582) has the molecular formula C12H12ClFN2O and a molecular weight of 254.69 g/mol. Its IUPAC name is 2-chloro-2-(1,3-diazinan-2-ylidene)-1-(4-fluorophenyl)ethanone.
| Compound Name | 2-chloro-2-(1,3-diazinan-2-ylidene)-1-(4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 10848582 |
| Molecular Formula | C12H12ClFN2O |
| Molecular Weight | 254.69 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 2-chloro-2-(1,3-diazinan-2-ylidene)-1-(4-fluorophenyl)ethanone |
| SMILES | O=C(C(Cl)=C1NCCCN1)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H12ClFN2O/c13-10(12-15-6-1-7-16-12)11(17)8-2-4-9(14)5-3-8/h2-5,15-16H,1,6-7H2 |
| InChIKey | HJHYRTNXUFBZOS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.69 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|