About 3,3-dimethyl-N-propylbicyclo[2.2.1]heptan-2-amine;hydrochloride
3,3-dimethyl-N-propylbicyclo[2.2.1]heptan-2-amine;hydrochloride (PubChem CID 138397483) has the molecular formula C12H24ClN
and a molecular weight of 217.78 g/mol. Its IUPAC name is 3,3-dimethyl-N-propylbicyclo[2.2.1]heptan-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 3,3-dimethyl-N-propylbicyclo[2.2.1]heptan-2-amine;hydrochloride |
| PubChem CID | 138397483 |
| Molecular Formula | C12H24ClN |
| Molecular Weight | 217.78 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 3,3-dimethyl-N-propylbicyclo[2.2.1]heptan-2-amine;hydrochloride |
| SMILES | CCCNC1C2CCC(C2)C1(C)C.Cl |
| InChI | InChI=1S/C12H23N.ClH/c1-4-7-13-11-9-5-6-10(8-9)12(11,2)3;/h9-11,13H,4-8H2,1-3H3;1H |
| InChIKey | GIBXCULGCJKZFM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.78 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,3-dimethyl-N-propylbicyclo[2.2.1]heptan-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-N-propylbicyclo[2.2.1]heptan-2-amine;hydrochloride?
The IUPAC name of 3,3-dimethyl-N-propylbicyclo[2.2.1]heptan-2-amine;hydrochloride (CID 138397483) is 3,3-dimethyl-N-propylbicyclo[2.2.1]heptan-2-amine;hydrochloride.
What is the SMILES notation for 3,3-dimethyl-N-propylbicyclo[2.2.1]heptan-2-amine;hydrochloride?
The canonical SMILES for 3,3-dimethyl-N-propylbicyclo[2.2.1]heptan-2-amine;hydrochloride is CCCNC1C2CCC(C2)C1(C)C.Cl.
What is the InChIKey of 3,3-dimethyl-N-propylbicyclo[2.2.1]heptan-2-amine;hydrochloride?
The InChIKey is GIBXCULGCJKZFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N.ClH/c1-4-7-13-11-9-5-6-10(8-9)12(11,2)3;/h9-11,13H,4-8H2,1-3H3;1H.
What are the key properties of 3,3-dimethyl-N-propylbicyclo[2.2.1]heptan-2-amine;hydrochloride?
3,3-dimethyl-N-propylbicyclo[2.2.1]heptan-2-amine;hydrochloride has a molecular weight of 217.78 g/mol, XLogP of 3.23, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-N-propylbicyclo[2.2.1]heptan-2-amine;hydrochloride is sourced from PubChem (CID 138397483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).