About 3-(dimethylamino)propyl 2-benzylsulfanylbenzoate;hydrochloride
3-(dimethylamino)propyl 2-benzylsulfanylbenzoate;hydrochloride (PubChem CID 138397952) has the molecular formula C19H24ClNO2S
and a molecular weight of 365.93 g/mol. Its IUPAC name is 3-(dimethylamino)propyl 2-benzylsulfanylbenzoate;hydrochloride.
Molecular Properties
| Compound Name | 3-(dimethylamino)propyl 2-benzylsulfanylbenzoate;hydrochloride |
| PubChem CID | 138397952 |
| Molecular Formula | C19H24ClNO2S |
| Molecular Weight | 365.93 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 3-(dimethylamino)propyl 2-benzylsulfanylbenzoate;hydrochloride |
| SMILES | CN(C)CCCOC(=O)c1ccccc1SCc1ccccc1.Cl |
| InChI | InChI=1S/C19H23NO2S.ClH/c1-20(2)13-8-14-22-19(21)17-11-6-7-12-18(17)23-15-16-9-4-3-5-10-16;/h3-7,9-12H,8,13-15H2,1-2H3;1H |
| InChIKey | XFTAUJTYLXXSOK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.93 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(dimethylamino)propyl 2-benzylsulfanylbenzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)propyl 2-benzylsulfanylbenzoate;hydrochloride?
The IUPAC name of 3-(dimethylamino)propyl 2-benzylsulfanylbenzoate;hydrochloride (CID 138397952) is 3-(dimethylamino)propyl 2-benzylsulfanylbenzoate;hydrochloride.
What is the SMILES notation for 3-(dimethylamino)propyl 2-benzylsulfanylbenzoate;hydrochloride?
The canonical SMILES for 3-(dimethylamino)propyl 2-benzylsulfanylbenzoate;hydrochloride is CN(C)CCCOC(=O)c1ccccc1SCc1ccccc1.Cl.
What is the InChIKey of 3-(dimethylamino)propyl 2-benzylsulfanylbenzoate;hydrochloride?
The InChIKey is XFTAUJTYLXXSOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23NO2S.ClH/c1-20(2)13-8-14-22-19(21)17-11-6-7-12-18(17)23-15-16-9-4-3-5-10-16;/h3-7,9-12H,8,13-15H2,1-2H3;1H.
What are the key properties of 3-(dimethylamino)propyl 2-benzylsulfanylbenzoate;hydrochloride?
3-(dimethylamino)propyl 2-benzylsulfanylbenzoate;hydrochloride has a molecular weight of 365.93 g/mol, XLogP of 4.51, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)propyl 2-benzylsulfanylbenzoate;hydrochloride is sourced from PubChem (CID 138397952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).