About [1-(2-aminoethoxy)-1-oxopropan-2-yl] heptanoate;hydroiodide
[1-(2-aminoethoxy)-1-oxopropan-2-yl] heptanoate;hydroiodide (PubChem CID 138401878) has the molecular formula C12H24INO4
and a molecular weight of 373.23 g/mol. Its IUPAC name is [1-(2-aminoethoxy)-1-oxopropan-2-yl] heptanoate;hydroiodide.
Molecular Properties
| Compound Name | [1-(2-aminoethoxy)-1-oxopropan-2-yl] heptanoate;hydroiodide |
| PubChem CID | 138401878 |
| Molecular Formula | C12H24INO4 |
| Molecular Weight | 373.23 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | [1-(2-aminoethoxy)-1-oxopropan-2-yl] heptanoate;hydroiodide |
| SMILES | CCCCCCC(=O)OC(C)C(=O)OCCN.I |
| InChI | InChI=1S/C12H23NO4.HI/c1-3-4-5-6-7-11(14)17-10(2)12(15)16-9-8-13;/h10H,3-9,13H2,1-2H3;1H |
| InChIKey | VQFTUWXXVVXZPU-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.23 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [1-(2-aminoethoxy)-1-oxopropan-2-yl] heptanoate;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2-aminoethoxy)-1-oxopropan-2-yl] heptanoate;hydroiodide?
The IUPAC name of [1-(2-aminoethoxy)-1-oxopropan-2-yl] heptanoate;hydroiodide (CID 138401878) is [1-(2-aminoethoxy)-1-oxopropan-2-yl] heptanoate;hydroiodide.
What is the SMILES notation for [1-(2-aminoethoxy)-1-oxopropan-2-yl] heptanoate;hydroiodide?
The canonical SMILES for [1-(2-aminoethoxy)-1-oxopropan-2-yl] heptanoate;hydroiodide is CCCCCCC(=O)OC(C)C(=O)OCCN.I.
What is the InChIKey of [1-(2-aminoethoxy)-1-oxopropan-2-yl] heptanoate;hydroiodide?
The InChIKey is VQFTUWXXVVXZPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO4.HI/c1-3-4-5-6-7-11(14)17-10(2)12(15)16-9-8-13;/h10H,3-9,13H2,1-2H3;1H.
What are the key properties of [1-(2-aminoethoxy)-1-oxopropan-2-yl] heptanoate;hydroiodide?
[1-(2-aminoethoxy)-1-oxopropan-2-yl] heptanoate;hydroiodide has a molecular weight of 373.23 g/mol, XLogP of 2.01, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2-aminoethoxy)-1-oxopropan-2-yl] heptanoate;hydroiodide is sourced from PubChem (CID 138401878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).